C12H13BrF2O — CID 106269710
1-bromo-3-(cyclopentyloxymethyl)-2,4-difluorobenzene (PubChem CID 106269710) has the molecular formula C12H13BrF2O and a molecular weight of 291.13 g/mol. Its IUPAC name is 1-bromo-3-(cyclopentyloxymethyl)-2,4-difluorobenzene.
| Compound Name | 1-bromo-3-(cyclopentyloxymethyl)-2,4-difluorobenzene |
|---|---|
| PubChem CID | 106269710 |
| Molecular Formula | C12H13BrF2O |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | 1-bromo-3-(cyclopentyloxymethyl)-2,4-difluorobenzene |
| SMILES | Fc1ccc(Br)c(F)c1COC1CCCC1 |
| InChI | InChI=1S/C12H13BrF2O/c13-10-5-6-11(14)9(12(10)15)7-16-8-3-1-2-4-8/h5-6,8H,1-4,7H2 |
| InChIKey | MZAYVJJCGOLCGT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|