C14H19F2NO2 — CID 115883414
2-[1-[(2,6-difluorophenyl)methyl]piperidin-4-yl]oxyethanol (PubChem CID 115883414) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 2-[1-[(2,6-difluorophenyl)methyl]piperidin-4-yl]oxyethanol.
| Compound Name | 2-[1-[(2,6-difluorophenyl)methyl]piperidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 115883414 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-[1-[(2,6-difluorophenyl)methyl]piperidin-4-yl]oxyethanol |
| SMILES | OCCOC1CCN(Cc2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C14H19F2NO2/c15-13-2-1-3-14(16)12(13)10-17-6-4-11(5-7-17)19-9-8-18/h1-3,11,18H,4-10H2 |
| InChIKey | SIGKMHMYSAIJBN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |