C15H21BrF2N2 — CID 106273530
1-[(3-bromo-2,6-difluorophenyl)methyl]-3-ethyl-3-methyl-1,4-diazepane (PubChem CID 106273530) has the molecular formula C15H21BrF2N2 and a molecular weight of 347.25 g/mol. Its IUPAC name is 1-[(3-bromo-2,6-difluorophenyl)methyl]-3-ethyl-3-methyl-1,4-diazepane.
| Compound Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-3-ethyl-3-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 106273530 |
| Molecular Formula | C15H21BrF2N2 |
| Molecular Weight | 347.25 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-[(3-bromo-2,6-difluorophenyl)methyl]-3-ethyl-3-methyl-1,4-diazepane |
| SMILES | CCC1(C)CN(Cc2c(F)ccc(Br)c2F)CCCN1 |
| InChI | InChI=1S/C15H21BrF2N2/c1-3-15(2)10-20(8-4-7-19-15)9-11-13(17)6-5-12(16)14(11)18/h5-6,19H,3-4,7-10H2,1-2H3 |
| InChIKey | CHRNCWWUWOMNKQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.25 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|