C14H19BrF2N2 — CID 102855217
1-(5-bromo-2,4-difluorophenyl)-3-ethyl-3-methyl-1,4-diazepane (PubChem CID 102855217) has the molecular formula C14H19BrF2N2 and a molecular weight of 333.22 g/mol. Its IUPAC name is 1-(5-bromo-2,4-difluorophenyl)-3-ethyl-3-methyl-1,4-diazepane.
| Compound Name | 1-(5-bromo-2,4-difluorophenyl)-3-ethyl-3-methyl-1,4-diazepane |
|---|---|
| PubChem CID | 102855217 |
| Molecular Formula | C14H19BrF2N2 |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 1-(5-bromo-2,4-difluorophenyl)-3-ethyl-3-methyl-1,4-diazepane |
| SMILES | CCC1(C)CN(c2cc(Br)c(F)cc2F)CCCN1 |
| InChI | InChI=1S/C14H19BrF2N2/c1-3-14(2)9-19(6-4-5-18-14)13-7-10(15)11(16)8-12(13)17/h7-8,18H,3-6,9H2,1-2H3 |
| InChIKey | WBJYRSWFAPPLNM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|