C12H17BrFN3 — CID 66110288
5-bromo-4-fluoro-2-(4-methyl-1,4-diazepan-1-yl)aniline (PubChem CID 66110288) has the molecular formula C12H17BrFN3 and a molecular weight of 302.19 g/mol. Its IUPAC name is 5-bromo-4-fluoro-2-(4-methyl-1,4-diazepan-1-yl)aniline.
| Compound Name | 5-bromo-4-fluoro-2-(4-methyl-1,4-diazepan-1-yl)aniline |
|---|---|
| PubChem CID | 66110288 |
| Molecular Formula | C12H17BrFN3 |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-bromo-4-fluoro-2-(4-methyl-1,4-diazepan-1-yl)aniline |
| SMILES | CN1CCCN(c2cc(F)c(Br)cc2N)CC1 |
| InChI | InChI=1S/C12H17BrFN3/c1-16-3-2-4-17(6-5-16)12-8-10(14)9(13)7-11(12)15/h7-8H,2-6,15H2,1H3 |
| InChIKey | PKCPOKDEIJCRJL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|