C10H17BrN2O2 — CID 79936793
1-(5-bromopentyl)-4-methylpiperazine-2,5-dione (PubChem CID 79936793) has the molecular formula C10H17BrN2O2 and a molecular weight of 277.16 g/mol. Its IUPAC name is 1-(5-bromopentyl)-4-methylpiperazine-2,5-dione.
| Compound Name | 1-(5-bromopentyl)-4-methylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 79936793 |
| Molecular Formula | C10H17BrN2O2 |
| Molecular Weight | 277.16 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-(5-bromopentyl)-4-methylpiperazine-2,5-dione |
| SMILES | CN1CC(=O)N(CCCCCBr)CC1=O |
| InChI | InChI=1S/C10H17BrN2O2/c1-12-7-10(15)13(8-9(12)14)6-4-2-3-5-11/h2-8H2,1H3 |
| InChIKey | VWRSDZCEXYPKQU-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.16 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|