C13H25N4O3P — CID 143079763
1,3-dimethyl-4-phosphanylideneimidazolidin-2-one;ethane;1-ethyl-3-methylimidazolidine-2,4-dione (PubChem CID 143079763) has the molecular formula C13H25N4O3P and a molecular weight of 316.34 g/mol. Its IUPAC name is 1,3-dimethyl-4-phosphanylideneimidazolidin-2-one;ethane;1-ethyl-3-methylimidazolidine-2,4-dione.
| Compound Name | 1,3-dimethyl-4-phosphanylideneimidazolidin-2-one;ethane;1-ethyl-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143079763 |
| Molecular Formula | C13H25N4O3P |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 1,3-dimethyl-4-phosphanylideneimidazolidin-2-one;ethane;1-ethyl-3-methylimidazolidine-2,4-dione |
| SMILES | CC.CCN1CC(=O)N(C)C1=O.[H]/P=C1\CN(C)C(=O)N1C |
| InChI | InChI=1S/C6H10N2O2.C5H9N2OP.C2H6/c1-3-8-4-5(9)7(2)6(8)10;1-6-3-4(9)7(2)5(6)8;1-2/h3-4H2,1-2H3;9H,3H2,1-2H3;1-2H3 |
| InChIKey | WGMAKIOTNHIMJZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|