C14H28N2O2Si — CID 140848592
1-ethyl-3-tripropylsilylimidazolidine-2,4-dione (PubChem CID 140848592) has the molecular formula C14H28N2O2Si and a molecular weight of 284.48 g/mol. Its IUPAC name is 1-ethyl-3-tripropylsilylimidazolidine-2,4-dione.
| Compound Name | 1-ethyl-3-tripropylsilylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140848592 |
| Molecular Formula | C14H28N2O2Si |
| Molecular Weight | 284.48 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1-ethyl-3-tripropylsilylimidazolidine-2,4-dione |
| SMILES | CCC[Si](CCC)(CCC)N1C(=O)CN(CC)C1=O |
| InChI | InChI=1S/C14H28N2O2Si/c1-5-9-19(10-6-2,11-7-3)16-13(17)12-15(8-4)14(16)18/h5-12H2,1-4H3 |
| InChIKey | CUWAKGKFESTQIC-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|