C18H36N2O2Si — CID 140848638
1,5,5-triethyl-3-tripropylsilylimidazolidine-2,4-dione (PubChem CID 140848638) has the molecular formula C18H36N2O2Si and a molecular weight of 340.58 g/mol. Its IUPAC name is 1,5,5-triethyl-3-tripropylsilylimidazolidine-2,4-dione.
| Compound Name | 1,5,5-triethyl-3-tripropylsilylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140848638 |
| Molecular Formula | C18H36N2O2Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.25 |
| IUPAC Name | 1,5,5-triethyl-3-tripropylsilylimidazolidine-2,4-dione |
| SMILES | CCC[Si](CCC)(CCC)N1C(=O)N(CC)C(CC)(CC)C1=O |
| InChI | InChI=1S/C18H36N2O2Si/c1-7-13-23(14-8-2,15-9-3)20-16(21)18(10-4,11-5)19(12-6)17(20)22/h7-15H2,1-6H3 |
| InChIKey | JPXGKHAWWTYSCV-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|