C19H22N2O3 — CID 789461
(4S,5S)-1,3-diethyl-4,5-dihydroxy-4,5-diphenylimidazolidin-2-one (PubChem CID 789461) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is (4S,5S)-1,3-diethyl-4,5-dihydroxy-4,5-diphenylimidazolidin-2-one.
| Compound Name | (4S,5S)-1,3-diethyl-4,5-dihydroxy-4,5-diphenylimidazolidin-2-one |
|---|---|
| PubChem CID | 789461 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | (4S,5S)-1,3-diethyl-4,5-dihydroxy-4,5-diphenylimidazolidin-2-one |
| SMILES | CCN1C(=O)N(CC)[C@](O)(c2ccccc2)[C@@]1(O)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-3-20-17(22)21(4-2)19(24,16-13-9-6-10-14-16)18(20,23)15-11-7-5-8-12-15/h5-14,23-24H,3-4H2,1-2H3/t18-,19-/m0/s1 |
| InChIKey | MBBSWOGYGKCKIE-OALUTQOASA-N |
| XLogP | 2.45 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |