C19H19Cl2NO2 — CID 134847338
1-benzyl-3,3-dichloro-5-hydroxy-4,4-dimethyl-5-phenylpyrrolidin-2-one (PubChem CID 134847338) has the molecular formula C19H19Cl2NO2 and a molecular weight of 364.27 g/mol. Its IUPAC name is 1-benzyl-3,3-dichloro-5-hydroxy-4,4-dimethyl-5-phenylpyrrolidin-2-one.
| Compound Name | 1-benzyl-3,3-dichloro-5-hydroxy-4,4-dimethyl-5-phenylpyrrolidin-2-one |
|---|---|
| PubChem CID | 134847338 |
| Molecular Formula | C19H19Cl2NO2 |
| Molecular Weight | 364.27 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-benzyl-3,3-dichloro-5-hydroxy-4,4-dimethyl-5-phenylpyrrolidin-2-one |
| SMILES | CC1(C)C(Cl)(Cl)C(=O)N(Cc2ccccc2)C1(O)c1ccccc1 |
| InChI | InChI=1S/C19H19Cl2NO2/c1-17(2)18(20,21)16(23)22(13-14-9-5-3-6-10-14)19(17,24)15-11-7-4-8-12-15/h3-12,24H,13H2,1-2H3 |
| InChIKey | OTORVRSSULPWCM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.27 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|