C14H16Cl3NO — CID 10041714
1-benzyl-3,3-dichloro-4-(chloromethyl)-5,5-dimethylpyrrolidin-2-one (PubChem CID 10041714) has the molecular formula C14H16Cl3NO and a molecular weight of 320.65 g/mol. Its IUPAC name is 1-benzyl-3,3-dichloro-4-(chloromethyl)-5,5-dimethylpyrrolidin-2-one.
| Compound Name | 1-benzyl-3,3-dichloro-4-(chloromethyl)-5,5-dimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 10041714 |
| Molecular Formula | C14H16Cl3NO |
| Molecular Weight | 320.65 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 1-benzyl-3,3-dichloro-4-(chloromethyl)-5,5-dimethylpyrrolidin-2-one |
| SMILES | CC1(C)C(CCl)C(Cl)(Cl)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H16Cl3NO/c1-13(2)11(8-15)14(16,17)12(19)18(13)9-10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | HGRBZMNWXMWOCO-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.65 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|