C13H14Cl3NO — CID 100987586
(3R,4R)-1-benzyl-3-chloro-4-(dichloromethyl)-3-methylpyrrolidin-2-one (PubChem CID 100987586) has the molecular formula C13H14Cl3NO and a molecular weight of 306.62 g/mol. Its IUPAC name is (3R,4R)-1-benzyl-3-chloro-4-(dichloromethyl)-3-methylpyrrolidin-2-one.
| Compound Name | (3R,4R)-1-benzyl-3-chloro-4-(dichloromethyl)-3-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 100987586 |
| Molecular Formula | C13H14Cl3NO |
| Molecular Weight | 306.62 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | (3R,4R)-1-benzyl-3-chloro-4-(dichloromethyl)-3-methylpyrrolidin-2-one |
| SMILES | C[C@]1(Cl)C(=O)N(Cc2ccccc2)C[C@H]1C(Cl)Cl |
| InChI | InChI=1S/C13H14Cl3NO/c1-13(16)10(11(14)15)8-17(12(13)18)7-9-5-3-2-4-6-9/h2-6,10-11H,7-8H2,1H3/t10-,13+/m0/s1 |
| InChIKey | UYQWEHJQKDMBRA-GXFFZTMASA-N |
| XLogP | 3.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.62 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|