C17H23Cl2NO — CID 100987573
(3R,4S)-1-benzyl-3-chloro-4-(2-chloropropan-2-yl)-3-propylpyrrolidin-2-one (PubChem CID 100987573) has the molecular formula C17H23Cl2NO and a molecular weight of 328.28 g/mol. Its IUPAC name is (3R,4S)-1-benzyl-3-chloro-4-(2-chloropropan-2-yl)-3-propylpyrrolidin-2-one.
| Compound Name | (3R,4S)-1-benzyl-3-chloro-4-(2-chloropropan-2-yl)-3-propylpyrrolidin-2-one |
|---|---|
| PubChem CID | 100987573 |
| Molecular Formula | C17H23Cl2NO |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | (3R,4S)-1-benzyl-3-chloro-4-(2-chloropropan-2-yl)-3-propylpyrrolidin-2-one |
| SMILES | CCC[C@]1(Cl)C(=O)N(Cc2ccccc2)C[C@H]1C(C)(C)Cl |
| InChI | InChI=1S/C17H23Cl2NO/c1-4-10-17(19)14(16(2,3)18)12-20(15(17)21)11-13-8-6-5-7-9-13/h5-9,14H,4,10-12H2,1-3H3/t14-,17+/m0/s1 |
| InChIKey | FKDQYLSDFXWUBQ-WMLDXEAASA-N |
| XLogP | 4.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|