C20H29Cl2NO — CID 100987578
(3S,4R)-1-benzyl-3-chloro-4-(2-chloropropan-2-yl)-3-hexylpyrrolidin-2-one (PubChem CID 100987578) has the molecular formula C20H29Cl2NO and a molecular weight of 370.36 g/mol. Its IUPAC name is (3S,4R)-1-benzyl-3-chloro-4-(2-chloropropan-2-yl)-3-hexylpyrrolidin-2-one.
| Compound Name | (3S,4R)-1-benzyl-3-chloro-4-(2-chloropropan-2-yl)-3-hexylpyrrolidin-2-one |
|---|---|
| PubChem CID | 100987578 |
| Molecular Formula | C20H29Cl2NO |
| Molecular Weight | 370.36 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (3S,4R)-1-benzyl-3-chloro-4-(2-chloropropan-2-yl)-3-hexylpyrrolidin-2-one |
| SMILES | CCCCCC[C@@]1(Cl)C(=O)N(Cc2ccccc2)C[C@@H]1C(C)(C)Cl |
| InChI | InChI=1S/C20H29Cl2NO/c1-4-5-6-10-13-20(22)17(19(2,3)21)15-23(18(20)24)14-16-11-8-7-9-12-16/h7-9,11-12,17H,4-6,10,13-15H2,1-3H3/t17-,20+/m1/s1 |
| InChIKey | UBXMMXOYWJUDPB-XLIONFOSSA-N |
| XLogP | 5.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.36 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|