C28H32N2O2Si — CID 140848602
1-benzyl-5,5-diphenyl-3-triethylsilylimidazolidine-2,4-dione (PubChem CID 140848602) has the molecular formula C28H32N2O2Si and a molecular weight of 456.66 g/mol. Its IUPAC name is 1-benzyl-5,5-diphenyl-3-triethylsilylimidazolidine-2,4-dione.
| Compound Name | 1-benzyl-5,5-diphenyl-3-triethylsilylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140848602 |
| Molecular Formula | C28H32N2O2Si |
| Molecular Weight | 456.66 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 1-benzyl-5,5-diphenyl-3-triethylsilylimidazolidine-2,4-dione |
| SMILES | CC[Si](CC)(CC)N1C(=O)N(Cc2ccccc2)C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C28H32N2O2Si/c1-4-33(5-2,6-3)30-26(31)28(24-18-12-8-13-19-24,25-20-14-9-15-21-25)29(27(30)32)22-23-16-10-7-11-17-23/h7-21H,4-6,22H2,1-3H3 |
| InChIKey | AMACNKVIUVKNKU-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.66 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|