C33H26N8O2 — CID 146037910
5,5-diphenyl-1,3-bis[(1-phenyltriazol-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 146037910) has the molecular formula C33H26N8O2 and a molecular weight of 566.63 g/mol. Its IUPAC name is 5,5-diphenyl-1,3-bis[(1-phenyltriazol-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diphenyl-1,3-bis[(1-phenyltriazol-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146037910 |
| Molecular Formula | C33H26N8O2 |
| Molecular Weight | 566.63 g/mol |
| Exact Mass | 566.22 |
| IUPAC Name | 5,5-diphenyl-1,3-bis[(1-phenyltriazol-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1N(Cc2cn(-c3ccccc3)nn2)C(=O)C(c2ccccc2)(c2ccccc2)N1Cc1cn(-c2ccccc2)nn1 |
| InChI | InChI=1S/C33H26N8O2/c42-31-33(25-13-5-1-6-14-25,26-15-7-2-8-16-26)39(22-28-24-41(37-35-28)30-19-11-4-12-20-30)32(43)38(31)21-27-23-40(36-34-27)29-17-9-3-10-18-29/h1-20,23-24H,21-22H2 |
| InChIKey | ZLNVFQVHSYPXFD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 102.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|