C33H22Cl2N10O6 — CID 146037933
1,3-bis[[1-(4-chloro-3-nitrophenyl)triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 146037933) has the molecular formula C33H22Cl2N10O6 and a molecular weight of 725.51 g/mol. Its IUPAC name is 1,3-bis[[1-(4-chloro-3-nitrophenyl)triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 1,3-bis[[1-(4-chloro-3-nitrophenyl)triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146037933 |
| Molecular Formula | C33H22Cl2N10O6 |
| Molecular Weight | 725.51 g/mol |
| Exact Mass | 724.11 |
| IUPAC Name | 1,3-bis[[1-(4-chloro-3-nitrophenyl)triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1N(Cc2cn(-c3ccc(Cl)c([N+](=O)[O-])c3)nn2)C(=O)C(c2ccccc2)(c2ccccc2)N1Cc1cn(-c2ccc(Cl)c([N+](=O)[O-])c2)nn1 |
| InChI | InChI=1S/C33H22Cl2N10O6/c34-27-13-11-25(15-29(27)44(48)49)42-19-23(36-38-42)17-40-31(46)33(21-7-3-1-4-8-21,22-9-5-2-6-10-22)41(32(40)47)18-24-20-43(39-37-24)26-12-14-28(35)30(16-26)45(50)51/h1-16,19-20H,17-18H2 |
| InChIKey | SUALBAJDHGMWQG-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 188.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|