C24H17ClN6O4 — CID 146037885
3-[[1-(4-chloro-3-nitrophenyl)triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 146037885) has the molecular formula C24H17ClN6O4 and a molecular weight of 488.89 g/mol. Its IUPAC name is 3-[[1-(4-chloro-3-nitrophenyl)triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[[1-(4-chloro-3-nitrophenyl)triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146037885 |
| Molecular Formula | C24H17ClN6O4 |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | 3-[[1-(4-chloro-3-nitrophenyl)triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1cn(-c2ccc(Cl)c([N+](=O)[O-])c2)nn1 |
| InChI | InChI=1S/C24H17ClN6O4/c25-20-12-11-19(13-21(20)31(34)35)30-15-18(27-28-30)14-29-22(32)24(26-23(29)33,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-13,15H,14H2,(H,26,33) |
| InChIKey | GZSYOOQQNPYXTQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 123.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|