C25H20ClN5O2 — CID 146037877
3-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 146037877) has the molecular formula C25H20ClN5O2 and a molecular weight of 457.92 g/mol. Its IUPAC name is 3-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 146037877 |
| Molecular Formula | C25H20ClN5O2 |
| Molecular Weight | 457.92 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 3-[[1-[(2-chlorophenyl)methyl]triazol-4-yl]methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1cn(Cc2ccccc2Cl)nn1 |
| InChI | InChI=1S/C25H20ClN5O2/c26-22-14-8-7-9-18(22)15-30-16-21(28-29-30)17-31-23(32)25(27-24(31)33,19-10-3-1-4-11-19)20-12-5-2-6-13-20/h1-14,16H,15,17H2,(H,27,33) |
| InChIKey | PLBADLUHASENJK-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.92 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|