C36H32N2O2Si — CID 140848438
5,5-diphenyl-1-propan-2-yl-3-triphenylsilylimidazolidine-2,4-dione (PubChem CID 140848438) has the molecular formula C36H32N2O2Si and a molecular weight of 552.75 g/mol. Its IUPAC name is 5,5-diphenyl-1-propan-2-yl-3-triphenylsilylimidazolidine-2,4-dione.
| Compound Name | 5,5-diphenyl-1-propan-2-yl-3-triphenylsilylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 140848438 |
| Molecular Formula | C36H32N2O2Si |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | 5,5-diphenyl-1-propan-2-yl-3-triphenylsilylimidazolidine-2,4-dione |
| SMILES | CC(C)N1C(=O)N([Si](c2ccccc2)(c2ccccc2)c2ccccc2)C(=O)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H32N2O2Si/c1-28(2)37-35(40)38(34(39)36(37,29-18-8-3-9-19-29)30-20-10-4-11-21-30)41(31-22-12-5-13-23-31,32-24-14-6-15-25-32)33-26-16-7-17-27-33/h3-28H,1-2H3 |
| InChIKey | WOXOQAUYJHELRA-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|