C24H23NOS — CID 10833174
3,3,4-triphenyl-1-propan-2-yl-4-sulfanylazetidin-2-one (PubChem CID 10833174) has the molecular formula C24H23NOS and a molecular weight of 373.52 g/mol. Its IUPAC name is 3,3,4-triphenyl-1-propan-2-yl-4-sulfanylazetidin-2-one.
| Compound Name | 3,3,4-triphenyl-1-propan-2-yl-4-sulfanylazetidin-2-one |
|---|---|
| PubChem CID | 10833174 |
| Molecular Formula | C24H23NOS |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 3,3,4-triphenyl-1-propan-2-yl-4-sulfanylazetidin-2-one |
| SMILES | CC(C)N1C(=O)C(c2ccccc2)(c2ccccc2)C1(S)c1ccccc1 |
| InChI | InChI=1S/C24H23NOS/c1-18(2)25-22(26)23(19-12-6-3-7-13-19,20-14-8-4-9-15-20)24(25,27)21-16-10-5-11-17-21/h3-18,27H,1-2H3 |
| InChIKey | FDXDNWDNVCQDDG-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|