C20H22ClNO — CID 12953546
4-(chloromethyl)-3,3-diphenyl-1-propan-2-ylpyrrolidin-2-one (PubChem CID 12953546) has the molecular formula C20H22ClNO and a molecular weight of 327.86 g/mol. Its IUPAC name is 4-(chloromethyl)-3,3-diphenyl-1-propan-2-ylpyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-3,3-diphenyl-1-propan-2-ylpyrrolidin-2-one |
|---|---|
| PubChem CID | 12953546 |
| Molecular Formula | C20H22ClNO |
| Molecular Weight | 327.86 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 4-(chloromethyl)-3,3-diphenyl-1-propan-2-ylpyrrolidin-2-one |
| SMILES | CC(C)N1CC(CCl)C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C20H22ClNO/c1-15(2)22-14-18(13-21)20(19(22)23,16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-12,15,18H,13-14H2,1-2H3 |
| InChIKey | HJVHZBRVMIZBPH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.86 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|