C26H32N2O6 — CID 71570081
(4R)-1-ethyl-4-(2-morpholin-4-ylethyl)-3,3-diphenylpyrrolidin-2-one;oxalic acid (PubChem CID 71570081) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is (4R)-1-ethyl-4-(2-morpholin-4-ylethyl)-3,3-diphenylpyrrolidin-2-one;oxalic acid.
| Compound Name | (4R)-1-ethyl-4-(2-morpholin-4-ylethyl)-3,3-diphenylpyrrolidin-2-one;oxalic acid |
|---|---|
| PubChem CID | 71570081 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | (4R)-1-ethyl-4-(2-morpholin-4-ylethyl)-3,3-diphenylpyrrolidin-2-one;oxalic acid |
| SMILES | CCN1C[C@H](CCN2CCOCC2)C(c2ccccc2)(c2ccccc2)C1=O.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H30N2O2.C2H2O4/c1-2-26-19-22(13-14-25-15-17-28-18-16-25)24(23(26)27,20-9-5-3-6-10-20)21-11-7-4-8-12-21;3-1(4)2(5)6/h3-12,22H,2,13-19H2,1H3;(H,3,4)(H,5,6)/t22-;/m0./s1 |
| InChIKey | ILEXDUMGMWPIJN-FTBISJDPSA-N |
| XLogP | 2.33 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|