C24H29N3O4 — CID 10949912
3-ethyl-1-(2-hydroxy-3-morpholin-4-ylpropyl)-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 10949912) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 3-ethyl-1-(2-hydroxy-3-morpholin-4-ylpropyl)-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-ethyl-1-(2-hydroxy-3-morpholin-4-ylpropyl)-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 10949912 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 3-ethyl-1-(2-hydroxy-3-morpholin-4-ylpropyl)-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)N(CC(O)CN2CCOCC2)C(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H29N3O4/c1-2-26-22(29)24(19-9-5-3-6-10-19,20-11-7-4-8-12-20)27(23(26)30)18-21(28)17-25-13-15-31-16-14-25/h3-12,21,28H,2,13-18H2,1H3 |
| InChIKey | QNEOWUHIVYTKST-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|