C25H35N3O4 — CID 29087489
(5S)-5-(4-acetyl-4-phenylpiperidine-1-carbonyl)-1-(2-morpholin-4-ylethyl)piperidin-2-one (PubChem CID 29087489) has the molecular formula C25H35N3O4 and a molecular weight of 441.57 g/mol. Its IUPAC name is (5S)-5-(4-acetyl-4-phenylpiperidine-1-carbonyl)-1-(2-morpholin-4-ylethyl)piperidin-2-one.
| Compound Name | (5S)-5-(4-acetyl-4-phenylpiperidine-1-carbonyl)-1-(2-morpholin-4-ylethyl)piperidin-2-one |
|---|---|
| PubChem CID | 29087489 |
| Molecular Formula | C25H35N3O4 |
| Molecular Weight | 441.57 g/mol |
| Exact Mass | 441.26 |
| IUPAC Name | (5S)-5-(4-acetyl-4-phenylpiperidine-1-carbonyl)-1-(2-morpholin-4-ylethyl)piperidin-2-one |
| SMILES | CC(=O)C1(c2ccccc2)CCN(C(=O)[C@H]2CCC(=O)N(CCN3CCOCC3)C2)CC1 |
| InChI | InChI=1S/C25H35N3O4/c1-20(29)25(22-5-3-2-4-6-22)9-11-27(12-10-25)24(31)21-7-8-23(30)28(19-21)14-13-26-15-17-32-18-16-26/h2-6,21H,7-19H2,1H3/t21-/m0/s1 |
| InChIKey | ASGWNUGKGRMHBG-NRFANRHFSA-N |
| XLogP | 1.71 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.57 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |