C15H22 — CID 166439838
[(1R,2R)-1-methyl-2-(3-methylbutyl)cyclopropyl]benzene (PubChem CID 166439838) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is [(1R,2R)-1-methyl-2-(3-methylbutyl)cyclopropyl]benzene.
| Compound Name | [(1R,2R)-1-methyl-2-(3-methylbutyl)cyclopropyl]benzene |
|---|---|
| PubChem CID | 166439838 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | [(1R,2R)-1-methyl-2-(3-methylbutyl)cyclopropyl]benzene |
| SMILES | CC(C)CC[C@@H]1C[C@@]1(C)c1ccccc1 |
| InChI | InChI=1S/C15H22/c1-12(2)9-10-14-11-15(14,3)13-7-5-4-6-8-13/h4-8,12,14H,9-11H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | HNAYDBSJYDHGGR-CABCVRRESA-N |
| XLogP | 4.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |