C17H28Si — CID 101158426
triethyl-[(2-methyl-2-phenylcyclopropyl)methyl]silane (PubChem CID 101158426) has the molecular formula C17H28Si and a molecular weight of 260.50 g/mol. Its IUPAC name is triethyl-[(2-methyl-2-phenylcyclopropyl)methyl]silane.
| Compound Name | triethyl-[(2-methyl-2-phenylcyclopropyl)methyl]silane |
|---|---|
| PubChem CID | 101158426 |
| Molecular Formula | C17H28Si |
| Molecular Weight | 260.50 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | triethyl-[(2-methyl-2-phenylcyclopropyl)methyl]silane |
| SMILES | CC[Si](CC)(CC)CC1CC1(C)c1ccccc1 |
| InChI | InChI=1S/C17H28Si/c1-5-18(6-2,7-3)14-16-13-17(16,4)15-11-9-8-10-12-15/h8-12,16H,5-7,13-14H2,1-4H3 |
| InChIKey | KYYHPTNKQCJSAJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|