cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid

C11H12O2 — CID 94252591

IUPACcis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid
SMILESC[C@]1(c2ccccc2)C[C@H]1C(=O)O
InChIInChI=1S/C11H12O2/c1-11(7-9(11)10(12)13)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,12,13)/t9-,11+/m0/s1
InChIKeyYQGDRMBKFXAICH-GXSJLCMTSA-N
MW176.22 g/mol
LogP2.05
Rot. Bonds2

About cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid

cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid (PubChem CID 94252591) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid
PubChem CID94252591
Molecular FormulaC11H12O2
Molecular Weight176.22 g/mol
Exact Mass176.08
IUPAC Namecis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid
SMILESC[C@]1(c2ccccc2)C[C@H]1C(=O)O
InChIInChI=1S/C11H12O2/c1-11(7-9(11)10(12)13)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,12,13)/t9-,11+/m0/s1
InChIKeyYQGDRMBKFXAICH-GXSJLCMTSA-N
XLogP2.05
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.22
LogP ≤ 52.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid (CID 94252591) is cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid is C[C@]1(c2ccccc2)C[C@H]1C(=O)O.
What is the InChIKey of cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid?
The InChIKey is YQGDRMBKFXAICH-GXSJLCMTSA-N. The full InChI is InChI=1S/C11H12O2/c1-11(7-9(11)10(12)13)8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H,12,13)/t9-,11+/m0/s1.
What are the key properties of cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid?
cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid has a molecular weight of 176.22 g/mol, XLogP of 2.05, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-methyl-2-phenylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 94252591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).