C22H17ClNO2P — CID 141471660
1-chloro-3,3,4-triphenyl-4-phosphanylpyrrolidine-2,5-dione (PubChem CID 141471660) has the molecular formula C22H17ClNO2P and a molecular weight of 393.81 g/mol. Its IUPAC name is 1-chloro-3,3,4-triphenyl-4-phosphanylpyrrolidine-2,5-dione.
| Compound Name | 1-chloro-3,3,4-triphenyl-4-phosphanylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 141471660 |
| Molecular Formula | C22H17ClNO2P |
| Molecular Weight | 393.81 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 1-chloro-3,3,4-triphenyl-4-phosphanylpyrrolidine-2,5-dione |
| SMILES | O=C1N(Cl)C(=O)C(c2ccccc2)(c2ccccc2)C1(P)c1ccccc1 |
| InChI | InChI=1S/C22H17ClNO2P/c23-24-19(25)21(16-10-4-1-5-11-16,17-12-6-2-7-13-17)22(27,20(24)26)18-14-8-3-9-15-18/h1-15H,27H2 |
| InChIKey | VFKSNBGXFCIOGN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.81 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|