C48H30N8O4 — CID 177144892
2,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3a,6a-diphenylpyrrolo[3,4-c]pyrrole-1,3,4,6-tetrone (PubChem CID 177144892) has the molecular formula C48H30N8O4 and a molecular weight of 782.82 g/mol. Its IUPAC name is 2,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3a,6a-diphenylpyrrolo[3,4-c]pyrrole-1,3,4,6-tetrone.
| Compound Name | 2,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3a,6a-diphenylpyrrolo[3,4-c]pyrrole-1,3,4,6-tetrone |
|---|---|
| PubChem CID | 177144892 |
| Molecular Formula | C48H30N8O4 |
| Molecular Weight | 782.82 g/mol |
| Exact Mass | 782.24 |
| IUPAC Name | 2,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-3a,6a-diphenylpyrrolo[3,4-c]pyrrole-1,3,4,6-tetrone |
| SMILES | O=C1N(c2nc(-c3ccccc3)nc(-c3ccccc3)n2)C(=O)C2(c3ccccc3)C(=O)N(c3nc(-c4ccccc4)nc(-c4ccccc4)n3)C(=O)C12c1ccccc1 |
| InChI | InChI=1S/C48H30N8O4/c57-41-47(35-27-15-5-16-28-35)43(59)56(46-53-39(33-23-11-3-12-24-33)50-40(54-46)34-25-13-4-14-26-34)44(60)48(47,36-29-17-6-18-30-36)42(58)55(41)45-51-37(31-19-7-1-8-20-31)49-38(52-45)32-21-9-2-10-22-32/h1-30H |
| InChIKey | ARKMICARDQUKJY-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 152.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.82 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|