C54H40N8Si2 — CID 90294941
1,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-2,2,4,4-tetraphenyl-1,3,2,4-diazadisiletidine (PubChem CID 90294941) has the molecular formula C54H40N8Si2 and a molecular weight of 857.14 g/mol. Its IUPAC name is 1,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-2,2,4,4-tetraphenyl-1,3,2,4-diazadisiletidine.
| Compound Name | 1,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-2,2,4,4-tetraphenyl-1,3,2,4-diazadisiletidine |
|---|---|
| PubChem CID | 90294941 |
| Molecular Formula | C54H40N8Si2 |
| Molecular Weight | 857.14 g/mol |
| Exact Mass | 856.29 |
| IUPAC Name | 1,3-bis(4,6-diphenyl-1,3,5-triazin-2-yl)-2,2,4,4-tetraphenyl-1,3,2,4-diazadisiletidine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(N3[Si](c4ccccc4)(c4ccccc4)N(c4nc(-c5ccccc5)nc(-c5ccccc5)n4)[Si]3(c3ccccc3)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C54H40N8Si2/c1-9-25-41(26-10-1)49-55-50(42-27-11-2-12-28-42)58-53(57-49)61-63(45-33-17-5-18-34-45,46-35-19-6-20-36-46)62(64(61,47-37-21-7-22-38-47)48-39-23-8-24-40-48)54-59-51(43-29-13-3-14-30-43)56-52(60-54)44-31-15-4-16-32-44/h1-40H |
| InChIKey | YQEVRDZAMINOKV-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 83.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.14 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|