C58H44N4Si2 — CID 90294942
2,2,4,4-tetraphenyl-1,3-bis[6-(3-phenylphenyl)-2-pyridinyl]-1,3,2,4-diazadisiletidine (PubChem CID 90294942) has the molecular formula C58H44N4Si2 and a molecular weight of 853.19 g/mol. Its IUPAC name is 2,2,4,4-tetraphenyl-1,3-bis[6-(3-phenylphenyl)-2-pyridinyl]-1,3,2,4-diazadisiletidine.
| Compound Name | 2,2,4,4-tetraphenyl-1,3-bis[6-(3-phenylphenyl)-2-pyridinyl]-1,3,2,4-diazadisiletidine |
|---|---|
| PubChem CID | 90294942 |
| Molecular Formula | C58H44N4Si2 |
| Molecular Weight | 853.19 g/mol |
| Exact Mass | 852.31 |
| IUPAC Name | 2,2,4,4-tetraphenyl-1,3-bis[6-(3-phenylphenyl)-2-pyridinyl]-1,3,2,4-diazadisiletidine |
| SMILES | c1ccc(-c2cccc(-c3cccc(N4[Si](c5ccccc5)(c5ccccc5)N(c5cccc(-c6cccc(-c7ccccc7)c6)n5)[Si]4(c4ccccc4)c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C58H44N4Si2/c1-7-23-45(24-8-1)47-27-19-29-49(43-47)55-39-21-41-57(59-55)61-63(51-31-11-3-12-32-51,52-33-13-4-14-34-52)62(64(61,53-35-15-5-16-36-53)54-37-17-6-18-38-54)58-42-22-40-56(60-58)50-30-20-28-48(44-50)46-25-9-2-10-26-46/h1-44H |
| InChIKey | KDGHGSQEXHRVPY-UHFFFAOYSA-N |
| XLogP | 10.98 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.19 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|