C56H38N6Si — CID 155647160
2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-11,11-diphenylbenzo[b][1]benzosilepin-9-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 155647160) has the molecular formula C56H38N6Si and a molecular weight of 823.05 g/mol. Its IUPAC name is 2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-11,11-diphenylbenzo[b][1]benzosilepin-9-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-11,11-diphenylbenzo[b][1]benzosilepin-9-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 155647160 |
| Molecular Formula | C56H38N6Si |
| Molecular Weight | 823.05 g/mol |
| Exact Mass | 822.29 |
| IUPAC Name | 2-[2-(4,6-diphenyl-1,3,5-triazin-2-yl)-11,11-diphenylbenzo[b][1]benzosilepin-9-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C1=Cc2ccc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc2[Si](c2ccccc2)(c2ccccc2)c2cc(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)ccc21 |
| InChI | InChI=1S/C56H38N6Si/c1-7-19-41(20-8-1)51-57-52(42-21-9-2-10-22-42)60-55(59-51)45-35-33-39-31-32-40-34-36-46(56-61-53(43-23-11-3-12-24-43)58-54(62-56)44-25-13-4-14-26-44)38-50(40)63(49(39)37-45,47-27-15-5-16-28-47)48-29-17-6-18-30-48/h1-38H |
| InChIKey | FQHVAUFWDNXHDG-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 823.05 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|