C57H39N3Si2 — CID 176643494
2-phenyl-4,6-bis[3-(5-phenylbenzo[b][1]benzosilol-5-yl)phenyl]-1,3,5-triazine (PubChem CID 176643494) has the molecular formula C57H39N3Si2 and a molecular weight of 822.13 g/mol. Its IUPAC name is 2-phenyl-4,6-bis[3-(5-phenylbenzo[b][1]benzosilol-5-yl)phenyl]-1,3,5-triazine.
| Compound Name | 2-phenyl-4,6-bis[3-(5-phenylbenzo[b][1]benzosilol-5-yl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 176643494 |
| Molecular Formula | C57H39N3Si2 |
| Molecular Weight | 822.13 g/mol |
| Exact Mass | 821.27 |
| IUPAC Name | 2-phenyl-4,6-bis[3-(5-phenylbenzo[b][1]benzosilol-5-yl)phenyl]-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3cccc([Si]4(c5ccccc5)c5ccccc5-c5ccccc54)c3)nc(-c3cccc([Si]4(c5ccccc5)c5ccccc5-c5ccccc54)c3)n2)cc1 |
| InChI | InChI=1S/C57H39N3Si2/c1-4-20-40(21-5-1)55-58-56(41-22-18-28-45(38-41)61(43-24-6-2-7-25-43)51-34-14-10-30-47(51)48-31-11-15-35-52(48)61)60-57(59-55)42-23-19-29-46(39-42)62(44-26-8-3-9-27-44)53-36-16-12-32-49(53)50-33-13-17-37-54(50)62/h1-39H |
| InChIKey | OXXOXWBAVRFALO-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.13 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|