C51H35N3Si — CID 155787247
2-[3-[3-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 155787247) has the molecular formula C51H35N3Si and a molecular weight of 717.95 g/mol. Its IUPAC name is 2-[3-[3-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[3-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 155787247 |
| Molecular Formula | C51H35N3Si |
| Molecular Weight | 717.95 g/mol |
| Exact Mass | 717.26 |
| IUPAC Name | 2-[3-[3-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)phenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5cccc6c5[Si](c5ccccc5)(c5ccccc5)c5ccccc5-6)c4)c3)n2)cc1 |
| InChI | InChI=1S/C51H35N3Si/c1-5-18-36(19-6-1)49-52-50(37-20-7-2-8-21-37)54-51(53-49)41-25-16-23-39(35-41)38-22-15-24-40(34-38)44-31-17-32-46-45-30-13-14-33-47(45)55(48(44)46,42-26-9-3-10-27-42)43-28-11-4-12-29-43/h1-35H |
| InChIKey | PCUFRIGTZQGICJ-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.95 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|