C52H36N2Si — CID 155787163
2-[3-[3-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)phenyl]phenyl]-4,6-diphenylpyrimidine (PubChem CID 155787163) has the molecular formula C52H36N2Si and a molecular weight of 716.96 g/mol. Its IUPAC name is 2-[3-[3-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)phenyl]phenyl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[3-[3-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)phenyl]phenyl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 155787163 |
| Molecular Formula | C52H36N2Si |
| Molecular Weight | 716.96 g/mol |
| Exact Mass | 716.26 |
| IUPAC Name | 2-[3-[3-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)phenyl]phenyl]-4,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5cccc6c5[Si](c5ccccc5)(c5ccccc5)c5ccccc5-6)c4)c3)n2)cc1 |
| InChI | InChI=1S/C52H36N2Si/c1-5-18-37(19-6-1)48-36-49(38-20-7-2-8-21-38)54-52(53-48)42-25-16-23-40(35-42)39-22-15-24-41(34-39)45-31-17-32-47-46-30-13-14-33-50(46)55(51(45)47,43-26-9-3-10-27-43)44-28-11-4-12-29-44/h1-36H |
| InChIKey | TYSSJFGGESDBGZ-UHFFFAOYSA-N |
| XLogP | 10.17 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.96 |
| LogP ≤ 5 | 10.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|