C64H42N2OSi — CID 171584528
4-(3-dibenzofuran-2-yl-5-phenylphenyl)-6-[4-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)phenyl]-2-phenylpyrimidine (PubChem CID 171584528) has the molecular formula C64H42N2OSi and a molecular weight of 883.14 g/mol. Its IUPAC name is 4-(3-dibenzofuran-2-yl-5-phenylphenyl)-6-[4-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)phenyl]-2-phenylpyrimidine.
| Compound Name | 4-(3-dibenzofuran-2-yl-5-phenylphenyl)-6-[4-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)phenyl]-2-phenylpyrimidine |
|---|---|
| PubChem CID | 171584528 |
| Molecular Formula | C64H42N2OSi |
| Molecular Weight | 883.14 g/mol |
| Exact Mass | 882.31 |
| IUPAC Name | 4-(3-dibenzofuran-2-yl-5-phenylphenyl)-6-[4-(5,5-diphenylbenzo[b][1]benzosilol-3-yl)phenyl]-2-phenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccc4oc5ccccc5c4c3)cc(-c3cc(-c4ccc(-c5ccc6c(c5)[Si](c5ccccc5)(c5ccccc5)c5ccccc5-6)cc4)nc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C64H42N2OSi/c1-5-17-43(18-6-1)49-37-50(47-34-36-61-57(40-47)54-25-13-15-27-60(54)67-61)39-51(38-49)59-42-58(65-64(66-59)46-19-7-2-8-20-46)45-31-29-44(30-32-45)48-33-35-56-55-26-14-16-28-62(55)68(63(56)41-48,52-21-9-3-10-22-52)53-23-11-4-12-24-53/h1-42H |
| InChIKey | UXMXUNKJRLMHCC-UHFFFAOYSA-N |
| XLogP | 13.74 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.14 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|