C47H34N2Si — CID 155787330
4-[3-[3-(5-methyl-5-phenylbenzo[b][1]benzosilol-3-yl)phenyl]phenyl]-2,6-diphenylpyrimidine (PubChem CID 155787330) has the molecular formula C47H34N2Si and a molecular weight of 654.89 g/mol. Its IUPAC name is 4-[3-[3-(5-methyl-5-phenylbenzo[b][1]benzosilol-3-yl)phenyl]phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[3-[3-(5-methyl-5-phenylbenzo[b][1]benzosilol-3-yl)phenyl]phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 155787330 |
| Molecular Formula | C47H34N2Si |
| Molecular Weight | 654.89 g/mol |
| Exact Mass | 654.25 |
| IUPAC Name | 4-[3-[3-(5-methyl-5-phenylbenzo[b][1]benzosilol-3-yl)phenyl]phenyl]-2,6-diphenylpyrimidine |
| SMILES | C[Si]1(c2ccccc2)c2ccccc2-c2ccc(-c3cccc(-c4cccc(-c5cc(-c6ccccc6)nc(-c6ccccc6)n5)c4)c3)cc21 |
| InChI | InChI=1S/C47H34N2Si/c1-50(40-23-9-4-10-24-40)45-26-12-11-25-41(45)42-28-27-38(31-46(42)50)36-20-13-19-35(29-36)37-21-14-22-39(30-37)44-32-43(33-15-5-2-6-16-33)48-47(49-44)34-17-7-3-8-18-34/h2-32H,1H3 |
| InChIKey | HQYFYTRKPHRYSJ-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.89 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|