C61H45NSi — CID 155787405
2-[4-[3-[3-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)phenyl]phenyl]phenyl]-4,6-bis(3-phenylphenyl)pyridine (PubChem CID 155787405) has the molecular formula C61H45NSi and a molecular weight of 820.12 g/mol. Its IUPAC name is 2-[4-[3-[3-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)phenyl]phenyl]phenyl]-4,6-bis(3-phenylphenyl)pyridine.
| Compound Name | 2-[4-[3-[3-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)phenyl]phenyl]phenyl]-4,6-bis(3-phenylphenyl)pyridine |
|---|---|
| PubChem CID | 155787405 |
| Molecular Formula | C61H45NSi |
| Molecular Weight | 820.12 g/mol |
| Exact Mass | 819.33 |
| IUPAC Name | 2-[4-[3-[3-(5,5-dimethylbenzo[b][1]benzosilol-2-yl)phenyl]phenyl]phenyl]-4,6-bis(3-phenylphenyl)pyridine |
| SMILES | C[Si]1(C)c2ccccc2-c2cc(-c3cccc(-c4cccc(-c5ccc(-c6cc(-c7cccc(-c8ccccc8)c7)cc(-c7cccc(-c8ccccc8)c7)n6)cc5)c4)c3)ccc21 |
| InChI | InChI=1S/C61H45NSi/c1-63(2)60-28-10-9-27-56(60)57-39-53(33-34-61(57)63)51-24-13-23-50(37-51)49-22-11-20-47(35-49)44-29-31-45(32-30-44)58-40-55(52-25-12-19-46(36-52)42-15-5-3-6-16-42)41-59(62-58)54-26-14-21-48(38-54)43-17-7-4-8-18-43/h3-41H,1-2H3 |
| InChIKey | CMGRWZDXUMFEAN-UHFFFAOYSA-N |
| XLogP | 15.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.12 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|