C43H33NSi — CID 155787420
4-[2-[4-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)phenyl]phenyl]-2,6-diphenylpyridine (PubChem CID 155787420) has the molecular formula C43H33NSi and a molecular weight of 591.83 g/mol. Its IUPAC name is 4-[2-[4-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)phenyl]phenyl]-2,6-diphenylpyridine.
| Compound Name | 4-[2-[4-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)phenyl]phenyl]-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 155787420 |
| Molecular Formula | C43H33NSi |
| Molecular Weight | 591.83 g/mol |
| Exact Mass | 591.24 |
| IUPAC Name | 4-[2-[4-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)phenyl]phenyl]-2,6-diphenylpyridine |
| SMILES | C[Si]1(C)c2ccccc2-c2ccc(-c3ccc(-c4ccccc4-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)cc3)cc21 |
| InChI | InChI=1S/C43H33NSi/c1-45(2)42-20-12-11-19-38(42)39-26-25-34(29-43(39)45)30-21-23-31(24-22-30)36-17-9-10-18-37(36)35-27-40(32-13-5-3-6-14-32)44-41(28-35)33-15-7-4-8-16-33/h3-29H,1-2H3 |
| InChIKey | GDZWVAGMYIYWDW-UHFFFAOYSA-N |
| XLogP | 10.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.83 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|