C25H21NSi — CID 153423347
2-[3-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)phenyl]pyridine (PubChem CID 153423347) has the molecular formula C25H21NSi and a molecular weight of 363.54 g/mol. Its IUPAC name is 2-[3-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)phenyl]pyridine.
| Compound Name | 2-[3-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 153423347 |
| Molecular Formula | C25H21NSi |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | 2-[3-(5,5-dimethylbenzo[b][1]benzosilol-3-yl)phenyl]pyridine |
| SMILES | C[Si]1(C)c2ccccc2-c2ccc(-c3cccc(-c4ccccn4)c3)cc21 |
| InChI | InChI=1S/C25H21NSi/c1-27(2)24-12-4-3-10-21(24)22-14-13-19(17-25(22)27)18-8-7-9-20(16-18)23-11-5-6-15-26-23/h3-17H,1-2H3 |
| InChIKey | KKBCEWMBGXDTDI-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|