C45H31N3Si — CID 155787192
2-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine (PubChem CID 155787192) has the molecular formula C45H31N3Si and a molecular weight of 641.85 g/mol. Its IUPAC name is 2-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 155787192 |
| Molecular Formula | C45H31N3Si |
| Molecular Weight | 641.85 g/mol |
| Exact Mass | 641.23 |
| IUPAC Name | 2-(5,5-diphenylbenzo[b][1]benzosilol-4-yl)-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3-c3ccccc3)nc(-c3cccc4c3[Si](c3ccccc3)(c3ccccc3)c3ccccc3-4)n2)cc1 |
| InChI | InChI=1S/C45H31N3Si/c1-5-18-32(19-6-1)36-26-13-14-28-39(36)44-46-43(33-20-7-2-8-21-33)47-45(48-44)40-30-17-29-38-37-27-15-16-31-41(37)49(42(38)40,34-22-9-3-10-23-34)35-24-11-4-12-25-35/h1-31H |
| InChIKey | KWGSTOMEMWMKCH-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.85 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|