C59H43N3Si2 — CID 156661442
2-(5,5-dimethyl-4-phenylbenzo[b][1]benzosilol-3-yl)-4-phenyl-6-(2,5,5-triphenylbenzo[b][1]benzosilol-3-yl)-1,3,5-triazine (PubChem CID 156661442) has the molecular formula C59H43N3Si2 and a molecular weight of 850.19 g/mol. Its IUPAC name is 2-(5,5-dimethyl-4-phenylbenzo[b][1]benzosilol-3-yl)-4-phenyl-6-(2,5,5-triphenylbenzo[b][1]benzosilol-3-yl)-1,3,5-triazine.
| Compound Name | 2-(5,5-dimethyl-4-phenylbenzo[b][1]benzosilol-3-yl)-4-phenyl-6-(2,5,5-triphenylbenzo[b][1]benzosilol-3-yl)-1,3,5-triazine |
|---|---|
| PubChem CID | 156661442 |
| Molecular Formula | C59H43N3Si2 |
| Molecular Weight | 850.19 g/mol |
| Exact Mass | 849.30 |
| IUPAC Name | 2-(5,5-dimethyl-4-phenylbenzo[b][1]benzosilol-3-yl)-4-phenyl-6-(2,5,5-triphenylbenzo[b][1]benzosilol-3-yl)-1,3,5-triazine |
| SMILES | C[Si]1(C)c2ccccc2-c2ccc(-c3nc(-c4ccccc4)nc(-c4cc5c(cc4-c4ccccc4)-c4ccccc4[Si]5(c4ccccc4)c4ccccc4)n3)c(-c3ccccc3)c21 |
| InChI | InChI=1S/C59H43N3Si2/c1-63(2)52-34-20-18-32-45(52)47-36-37-48(55(56(47)63)41-24-10-4-11-25-41)58-60-57(42-26-12-5-13-27-42)61-59(62-58)51-39-54-50(38-49(51)40-22-8-3-9-23-40)46-33-19-21-35-53(46)64(54,43-28-14-6-15-29-43)44-30-16-7-17-31-44/h3-39H,1-2H3 |
| InChIKey | UMMJDQUQHAPZCO-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.19 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|