C47H35N3Si — CID 155787204
2-[5,5-bis(4-methylphenyl)benzo[b][1]benzosilol-3-yl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine (PubChem CID 155787204) has the molecular formula C47H35N3Si and a molecular weight of 669.90 g/mol. Its IUPAC name is 2-[5,5-bis(4-methylphenyl)benzo[b][1]benzosilol-3-yl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[5,5-bis(4-methylphenyl)benzo[b][1]benzosilol-3-yl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 155787204 |
| Molecular Formula | C47H35N3Si |
| Molecular Weight | 669.90 g/mol |
| Exact Mass | 669.26 |
| IUPAC Name | 2-[5,5-bis(4-methylphenyl)benzo[b][1]benzosilol-3-yl]-4-phenyl-6-(2-phenylphenyl)-1,3,5-triazine |
| SMILES | Cc1ccc([Si]2(c3ccc(C)cc3)c3ccccc3-c3ccc(-c4nc(-c5ccccc5)nc(-c5ccccc5-c5ccccc5)n4)cc32)cc1 |
| InChI | InChI=1S/C47H35N3Si/c1-32-21-26-37(27-22-32)51(38-28-23-33(2)24-29-38)43-20-12-11-18-40(43)41-30-25-36(31-44(41)51)46-48-45(35-15-7-4-8-16-35)49-47(50-46)42-19-10-9-17-39(42)34-13-5-3-6-14-34/h3-31H,1-2H3 |
| InChIKey | JPMRFMURGPBJSN-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.90 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|