C55H43N3Si — CID 155787132
2-(3-tert-butyl-5,5-diphenylbenzo[b][1]benzosilol-7-yl)-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine (PubChem CID 155787132) has the molecular formula C55H43N3Si and a molecular weight of 774.06 g/mol. Its IUPAC name is 2-(3-tert-butyl-5,5-diphenylbenzo[b][1]benzosilol-7-yl)-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(3-tert-butyl-5,5-diphenylbenzo[b][1]benzosilol-7-yl)-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 155787132 |
| Molecular Formula | C55H43N3Si |
| Molecular Weight | 774.06 g/mol |
| Exact Mass | 773.32 |
| IUPAC Name | 2-(3-tert-butyl-5,5-diphenylbenzo[b][1]benzosilol-7-yl)-4-phenyl-6-[4-(4-phenylphenyl)phenyl]-1,3,5-triazine |
| SMILES | CC(C)(C)c1ccc2c(c1)[Si](c1ccccc1)(c1ccccc1)c1cc(-c3nc(-c4ccccc4)nc(-c4ccc(-c5ccc(-c6ccccc6)cc5)cc4)n3)ccc1-2 |
| InChI | InChI=1S/C55H43N3Si/c1-55(2,3)45-33-35-49-48-34-32-44(36-50(48)59(51(49)37-45,46-20-12-6-13-21-46)47-22-14-7-15-23-47)54-57-52(42-18-10-5-11-19-42)56-53(58-54)43-30-28-41(29-31-43)40-26-24-39(25-27-40)38-16-8-4-9-17-38/h4-37H,1-3H3 |
| InChIKey | NAGAYZAMQKLSPH-UHFFFAOYSA-N |
| XLogP | 10.86 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.06 |
| LogP ≤ 5 | 10.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|