C49H39N3Si2 — CID 156661404
2,4-bis(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-4-yl)-6-phenyl-1,3,5-triazine (PubChem CID 156661404) has the molecular formula C49H39N3Si2 and a molecular weight of 726.04 g/mol. Its IUPAC name is 2,4-bis(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-4-yl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2,4-bis(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-4-yl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 156661404 |
| Molecular Formula | C49H39N3Si2 |
| Molecular Weight | 726.04 g/mol |
| Exact Mass | 725.27 |
| IUPAC Name | 2,4-bis(5,5-dimethyl-3-phenylbenzo[b][1]benzosilol-4-yl)-6-phenyl-1,3,5-triazine |
| SMILES | C[Si]1(C)c2ccccc2-c2ccc(-c3ccccc3)c(-c3nc(-c4ccccc4)nc(-c4c(-c5ccccc5)ccc5c4[Si](C)(C)c4ccccc4-5)n3)c21 |
| InChI | InChI=1S/C49H39N3Si2/c1-53(2)41-26-16-14-24-37(41)39-30-28-35(32-18-8-5-9-19-32)43(45(39)53)48-50-47(34-22-12-7-13-23-34)51-49(52-48)44-36(33-20-10-6-11-21-33)29-31-40-38-25-15-17-27-42(38)54(3,4)46(40)44/h5-31H,1-4H3 |
| InChIKey | VTKQPVUWTJBFRV-UHFFFAOYSA-N |
| XLogP | 9.81 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.04 |
| LogP ≤ 5 | 9.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|