C43H31N3Si — CID 155787263
2-[10-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)anthracen-9-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 155787263) has the molecular formula C43H31N3Si and a molecular weight of 617.83 g/mol. Its IUPAC name is 2-[10-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)anthracen-9-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[10-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)anthracen-9-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 155787263 |
| Molecular Formula | C43H31N3Si |
| Molecular Weight | 617.83 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | 2-[10-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)anthracen-9-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C[Si]1(C)c2ccccc2-c2cccc(-c3c4ccccc4c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c4ccccc34)c21 |
| InChI | InChI=1S/C43H31N3Si/c1-47(2)37-27-14-13-20-30(37)35-25-15-26-36(40(35)47)38-31-21-9-11-23-33(31)39(34-24-12-10-22-32(34)38)43-45-41(28-16-5-3-6-17-28)44-42(46-43)29-18-7-4-8-19-29/h3-27H,1-2H3 |
| InChIKey | GAEYAZACVYZTQK-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.83 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|