C38H22N6O2 — CID 167304164
2,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)pentalene-1,4-dione (PubChem CID 167304164) has the molecular formula C38H22N6O2 and a molecular weight of 594.63 g/mol. Its IUPAC name is 2,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)pentalene-1,4-dione.
| Compound Name | 2,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)pentalene-1,4-dione |
|---|---|
| PubChem CID | 167304164 |
| Molecular Formula | C38H22N6O2 |
| Molecular Weight | 594.63 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | 2,5-bis(4,6-diphenyl-1,3,5-triazin-2-yl)pentalene-1,4-dione |
| SMILES | O=c1c(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)cc2c(=O)c(-c3nc(-c4ccccc4)nc(-c4ccccc4)n3)cc1=2 |
| InChI | InChI=1S/C38H22N6O2/c45-31-28-22-30(38-43-35(25-17-9-3-10-18-25)40-36(44-38)26-19-11-4-12-20-26)32(46)27(28)21-29(31)37-41-33(23-13-5-1-6-14-23)39-34(42-37)24-15-7-2-8-16-24/h1-22H |
| InChIKey | LEMHWLIFHZWMKC-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 111.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.63 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |