C24H23N3O2 — CID 177145002
1-(4,6-diphenylpyrimidin-2-yl)-3,3,4,4-tetramethylpyrrolidine-2,5-dione (PubChem CID 177145002) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-(4,6-diphenylpyrimidin-2-yl)-3,3,4,4-tetramethylpyrrolidine-2,5-dione.
| Compound Name | 1-(4,6-diphenylpyrimidin-2-yl)-3,3,4,4-tetramethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 177145002 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-(4,6-diphenylpyrimidin-2-yl)-3,3,4,4-tetramethylpyrrolidine-2,5-dione |
| SMILES | CC1(C)C(=O)N(c2nc(-c3ccccc3)cc(-c3ccccc3)n2)C(=O)C1(C)C |
| InChI | InChI=1S/C24H23N3O2/c1-23(2)20(28)27(21(29)24(23,3)4)22-25-18(16-11-7-5-8-12-16)15-19(26-22)17-13-9-6-10-14-17/h5-15H,1-4H3 |
| InChIKey | KRPYUAVQNFZQOG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|